Nitrobenzene-13C6 is a high-purity, isotopically labeled compound vital for advanced pharmaceutical and biochemical research. This version of nitrobenzene, enriched with six 13C atoms, is crucial for studying metabolic pathways, environmental analysis, and chemical synthesis. Its stable isotope labeling ensures precise and reliable analytical results. Ideal for applications in medicinal chemistry, toxicology, and analytical chemistry, Nitrobenzene-13C6 integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R018335 |
| CAS Number | 89059-37-0 |
| Synonyms | 1-Nitrobenzene-1,2,3,4,5,6-13C6 |
| Molecular Formula | C6H5NO2 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | nitrobenzene |
| InChI | InChI=1S/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | LQNUZADURLCDLV-IDEBNGHGSA-N |
| SMILES | C1=CC=C(C=C1)[N+](=O)[O-] |
