For research use only. Not for therapeutic Use.
Nitroethane-d3(Cat No.:M014432) is a deuterated form of nitroethane, where three hydrogen atoms are replaced with deuterium, a stable hydrogen isotope. This modification enhances its utility in scientific research, particularly in nuclear magnetic resonance (NMR) spectroscopy, where it is used to trace and analyze chemical reactions and molecular interactions. Deuterated compounds like nitroethane-d3 provide clearer NMR signals, allowing for more precise measurements. Nitroethane-d3 retains the characteristic properties of regular nitroethane, such as its solvent capabilities and reactivity in organic synthesis, making it valuable in both analytical and synthetic chemistry applications.
CAS Number | 1219802-04-6 |
Synonyms | Nitroethane-2,2,2-d3;1,1,1-Trideuterio-2-nitroethane. |
Molecular Formula | C2H5NO2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1,1,1-trideuterio-2-nitroethane |
InChI | InChI=1S/C2H5NO2/c1-2-3(4)5/h2H2,1H3/i1D3 |
InChIKey | MCSAJNNLRCFZED-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])C[N+](=O)[O-] |