For research use only. Not for therapeutic Use.
| Catalog Number | R005633 |
| CAS Number | 4199-88-6 |
| Molecular Formula | C12H7N3O2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| IUPAC Name | 5-nitro-1,10-phenanthroline |
| InChI | InChI=1S/C12H7N3O2/c16-15(17)10-7-8-3-1-5-13-11(8)12-9(10)4-2-6-14-12/h1-7H |
| InChIKey | PDDBTWXLNJNICS-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)[N+](=O)[O-] |
| Reference | Katzianer, D. S., Yano, T., Rubin, H., & Zhu, J. (2014). A high-throughput small-molecule screen to identify a novel chemical inhibitor ofClostridium difficile. International Journal of Antimicrobial Agents, 44(1), 69–73. http://doi.org/10.1016/j.ijantimicag.2014.03.007</span></p> |
