For research use only. Not for therapeutic Use.
NLRP3-IN-11（Cat No.:I042754）is a potent inhibitor of the NLRP3 inflammasome, exhibiting an IC₅₀ value of less than 0.3 μM. The NLRP3 inflammasome is a multiprotein complex involved in the activation of inflammatory responses, playing a crucial role in the maturation and secretion of pro-inflammatory cytokines such as interleukin-1β (IL-1β) and interleukin-18 (IL-18). By inhibiting NLRP3, NLRP3-IN-11 has potential therapeutic applications in various inflammatory and degenerative diseases, including non-alcoholic steatohepatitis (NASH), atherosclerosis, Alzheimer’s disease, Parkinson’s disease, diabetes, gout, and other autoinflammatory conditions.
| CAS Number | 2769040-91-5 |
| Synonyms | 5-chloro-2-[4-[(2-hydroxy-2-methylpropyl)amino]pyrido[3,4-d]pyridazin-1-yl]phenol |
| Molecular Formula | C17H17ClN4O2 |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-2-[4-[(2-hydroxy-2-methylpropyl)amino]pyrido[3,4-d]pyridazin-1-yl]phenol |
| InChI | InChI=1S/C17H17ClN4O2/c1-17(2,24)9-20-16-13-8-19-6-5-11(13)15(21-22-16)12-4-3-10(18)7-14(12)23/h3-8,23-24H,9H2,1-2H3,(H,20,22) |
| InChIKey | UDNICEVHCYUJFU-UHFFFAOYSA-N |
| SMILES | CC(C)(CNC1=NN=C(C2=C1C=NC=C2)C3=C(C=C(C=C3)Cl)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
