For research use only. Not for therapeutic Use.
NMDAR Antagonist 1（Cat No.:I009738）is a compound that selectively inhibits the N-methyl-D-aspartate receptor (NMDAR), a subtype of glutamate receptors in the brain. NMDARs play a crucial role in synaptic plasticity, learning, memory, and neuroprotection. By blocking NMDARs, this antagonist can modulate excitatory neurotransmission, which has therapeutic potential for conditions involving overactivation of glutamatergic pathways, such as Alzheimer’s disease, stroke, epilepsy, and chronic pain. Research into NMDAR Antagonist 1 focuses on its ability to reduce excitotoxicity while preserving normal cognitive functions, though its clinical development and safety are still under investigation.
| CAS Number | 2220162-06-9 |
| Molecular Formula | C₂₀H₂₀BrN₃O₂ |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| IUPAC Name | (1S)-7-bromo-N-[2-(4-hydroxyphenyl)ethyl]-1,2,3,9-tetrahydropyrrolo[2,1-b]quinazoline-1-carboxamide |
| InChI | InChI=1S/C20H20BrN3O2/c21-15-3-6-17-14(11-15)12-24-18(7-8-19(24)23-17)20(26)22-10-9-13-1-4-16(25)5-2-13/h1-6,11,18,25H,7-10,12H2,(H,22,26)/t18-/m0/s1 |
| InChIKey | NCHFPVRYYJGAJY-SFHVURJKSA-N |
| SMILES | C1CC2=NC3=C(CN2[C@@H]1C(=O)NCCC4=CC=C(C=C4)O)C=C(C=C3)Br |
