For research use only. Not for therapeutic Use.
NMS-P118(Cat No.:I001056)is a small molecule compound investigated for its potential therapeutic applications, particularly in cancer treatment. It acts as a selective inhibitor of the enzyme phosphoinositide 3-kinase (PI3K), which plays a critical role in cell growth, survival, and metabolism. By inhibiting PI3K, NMS-P118 aims to block signaling pathways that promote tumor growth and resistance to therapies. The compound has shown promise in preclinical studies for its ability to target cancer cells and disrupt key pathways involved in malignancy. Ongoing research continues to explore its clinical potential in oncology.
CAS Number | 1262417-51-5 |
Synonyms | 2-[1-(4,4-difluorocyclohexyl)-4-piperidinyl]-6-fluoro-2,3-dihydro-3-oxo-1H-isoindole-4-carboxamide |
Molecular Formula | C20H24F3N3O2 |
Purity | ≥95% |
Target | Epigenetics |
Solubility | DMSO: ≤ 16 mg/mL |
Storage | -20°C |
IUPAC Name | 2-[1-(4,4-difluorocyclohexyl)piperidin-4-yl]-6-fluoro-3-oxo-1H-isoindole-4-carboxamide |
InChI | InChI=1S/C20H24F3N3O2/c21-13-9-12-11-26(19(28)17(12)16(10-13)18(24)27)15-3-7-25(8-4-15)14-1-5-20(22,23)6-2-14/h9-10,14-15H,1-8,11H2,(H2,24,27) |
InChIKey | ARYVAQSYRLZVQD-UHFFFAOYSA-N |
SMILES | C1CC(CCC1N2CCC(CC2)N3CC4=C(C3=O)C(=CC(=C4)F)C(=O)N)(F)F |