For research use only. Not for therapeutic Use.
N, N-Bis(t-butyl-4-carboxymethyl)aminoethanol(Cat No.:M097309) is a specialized chemical compound featuring a central ethanolamine backbone with two t-butyl-4-carboxymethyl groups attached via amine linkages. This structure imparts both hydrophilic and lipophilic properties due to the presence of carboxymethyl groups and bulky t-butyl groups, respectively. It is commonly used in the synthesis of polymers, and surfactants, and as a ligand in coordination chemistry. The unique combination of functional groups makes it valuable for modifying the physical properties of materials, such as increasing solubility, and stability, and enhancing interaction with other molecular structures in various applications.
Catalog Number | M097309 |
CAS Number | 146432-41-9 |
Synonyms | N,N-BIS(T-BUTYL-4-CARBOXYMETHYL)AMINOETHANOL |
Molecular Formula | C14H27NO5 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | tert-butyl 2-[2-hydroxyethyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate |
InChI | InChI=1S/C14H27NO5/c1-13(2,3)19-11(17)9-15(7-8-16)10-12(18)20-14(4,5)6/h16H,7-10H2,1-6H3 |
InChIKey | IUZTVXAUVUVCLI-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)CN(CCO)CC(=O)OC(C)(C)C |