For research use only. Not for therapeutic Use.
N,N-Dibutyldodecanamide(CAT: L000313) is a significant compound within the field of material chemistry. This chemical functions as a lubricant and processing aid in the production of polymeric materials, especially polyolefins and elastomers. Its primary role is to enhance the flow and processability of these materials during manufacturing, contributing to the formation of more consistent and high-quality products.
CAS Number | 5343-44-2 |
Molecular Formula | C20H41NO |
Purity | ≥95% |
IUPAC Name | N,N-dibutyldodecanamide |
InChI | InChI=1S/C20H41NO/c1-4-7-10-11-12-13-14-15-16-17-20(22)21(18-8-5-2)19-9-6-3/h4-19H2,1-3H3 |
InChIKey | MFARGUPPFBTESX-UHFFFAOYSA-N |