For research use only. Not for therapeutic Use.
N, N’-Dicyclohexyl-2,6-naphthalenedicarboxamide(Cat No.:M105061) is a chemical compound that features a naphthalene backbone substituted with two cyclohexyl groups and amide functionalities. This molecular structure places it within the class of naphthalene derivatives, renowned for their potential in materials science, particularly in polymer development. The presence of cyclohexyl groups contributes to its bulky nature, which can influence the physical properties of polymers, such as melting temperature and solubility. This compound may also exhibit interesting optical properties due to the conjugated naphthalene core, making it a candidate for study in optoelectronic applications. Its chemical stability and unique structural features make it suitable for investigation in advanced materials synthesis.
Catalog Number | M105061 |
CAS Number | 153250-52-3 |
Synonyms | N,N’-DICYCLOHEXYL-2,6-NAPHTHALENEDICARBOXAMIDE |
Molecular Formula | C24H30N2O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-N,6-N-dicyclohexylnaphthalene-2,6-dicarboxamide |
InChI | InChI=1S/C24H30N2O2/c27-23(25-21-7-3-1-4-8-21)19-13-11-18-16-20(14-12-17(18)15-19)24(28)26-22-9-5-2-6-10-22/h11-16,21-22H,1-10H2,(H,25,27)(H,26,28) |
InChIKey | MBSRTKPGZKQXQR-UHFFFAOYSA-N |
SMILES | C1CCC(CC1)NC(=O)C2=CC3=C(C=C2)C=C(C=C3)C(=O)NC4CCCCC4 |