For research use only. Not for therapeutic Use.
N,N-Diethylaminoethyl acrylate is a versatile compound used in polymer chemistry. Its double bond allows it to participate in various polymerization reactions, contributing to the formation of polymers with diverse properties. With its amino and ethyl groups, it offers functionalities for modification and functionalization of polymers, enabling applications in adhesives, coatings, and biomedical materials. Its flexibility in polymerization processes and modification capabilities make it valuable in designing tailored polymer materials.
| Catalog Number | R070459 |
| CAS Number | 2426-54-2 |
| Synonyms | 2-Diethylaminoethyl acrylate |
| Molecular Formula | C9H17NO2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 2-(diethylamino)ethyl prop-2-enoate |
| InChI | InChI=1S/C9H17NO2/c1-4-9(11)12-8-7-10(5-2)6-3/h4H,1,5-8H2,2-3H3 |
| InChIKey | QHVBLSNVXDSMEB-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C=C |
