For research use only. Not for therapeutic Use.
N, N-Diethylcyclohexylamine（Cat No.:L006988）, is an organic compound with the molecular formula C10H21N. It is a colorless to pale yellow liquid with an amine-like odor. This compound is used as a catalyst, corrosion inhibitor, and chemical intermediate in various industrial applications. Its unique chemical properties make it valuable in organic synthesis, particularly in the production of specialty chemicals, pharmaceuticals, and agrochemicals. N, N-Diethylcyclohexylamine acts as a stabilizer in rubber and a curing agent for epoxy resins. Its versatility and reactivity contribute to its significance in diverse chemical processes, enhancing the efficiency and properties of various end products.
| CAS Number | 91-65-6 |
| Molecular Formula | C10H21N |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | N,N-diethylcyclohexanamine |
| InChI | InChI=1S/C10H21N/c1-3-11(4-2)10-8-6-5-7-9-10/h10H,3-9H2,1-2H3 |
| InChIKey | CIXSDMKDSYXUMJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1CCCCC1 |
