For research use only. Not for therapeutic Use.
N, N-Diethylnipecotamide(Cat No.: L006987) a nipecotic acid derivative, plays a pivotal role in pharmaceutical and organic chemistry. Its structure incorporates a nipecotic acid scaffold with N, N-diethyl substitution, impacting its biological activity and lipophilicity. In pharmaceutical research, it could be explored for its potential as a GABA uptake inhibitor, affecting neurotransmission. Its unique structure offers opportunities for structural modifications, contributing to drug design targeting neurological disorders.
| Catalog Number | L006987 |
| CAS Number | 3367-95-1 |
| Molecular Formula | C10H20N2O |
| Purity | ≥95% |
| IUPAC Name | N,N-diethylpiperidine-3-carboxamide |
| InChI | InChI=1S/C10H20N2O/c1-3-12(4-2)10(13)9-6-5-7-11-8-9/h9,11H,3-8H2,1-2H3 |
| InChIKey | ZXQKYQVJDRTTLZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1CCCNC1 |
