For research use only. Not for therapeutic Use.
N,N-Dimethyl-2-methylene-β-alanine (Cat No.: R016324) is a specialized compound used in organic synthesis and pharmaceutical research. It serves as a building block for creating complex molecules and studying chemical reaction mechanisms. This compound is essential for developing new therapeutic agents and understanding biochemical pathways, ensuring precise and reliable results in advanced scientific investigations.
CAS Number | 5415-98-5 |
Synonyms | 2-[(Dimethylamino)methyl]-2-propenoic Acid; 2-[(Dimethylamino)methyl]acrylic Acid; NSC 11325; |
Molecular Formula | C6H11NO2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-[(dimethylamino)methyl]prop-2-enoic acid |
InChI | InChI=1S/C6H11NO2/c1-5(6(8)9)4-7(2)3/h1,4H2,2-3H3,(H,8,9) |
InChIKey | GANOKKCPYBWVRC-UHFFFAOYSA-N |
SMILES | CN(C)CC(=C)C(=O)O |