For research use only. Not for therapeutic Use.
N, N’-Dimethyl-N-[2-(methylamino)ethyl]ethylenediamine(Cat No.:M070467), is a chemical compound commonly known as Dimethylaminoethylethylene diamine (DAEE). It is a clear, colorless liquid with applications in various industrial processes, including pharmaceuticals, agrochemicals, and the synthesis of surfactants. DAEE is utilized as a versatile chemical intermediate, playing a crucial role in the production of compounds like quaternary ammonium salts and corrosion inhibitors.
Catalog Number | M070467 |
CAS Number | 105-84-0 |
Molecular Formula | C7H19N3 |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | N,N/'-dimethyl-N/'-[2-(methylamino)ethyl]ethane-1,2-diamine |
InChI | InChI=1S/C7H19N3/c1-8-4-6-10(3)7-5-9-2/h8-9H,4-7H2,1-3H3 |
InChIKey | ODZZIKZQNODXFS-UHFFFAOYSA-N |
SMILES | CNCCN(C)CCNC |