For research use only. Not for therapeutic Use.
N,N-Dimethylbenzylamine (Benzyldimethylamine)(Cat No.:R022789)is a versatile chemical compound widely used in organic synthesis and industrial applications. As a tertiary amine, it serves as a catalyst in various polymerization processes, particularly in the production of polyurethane foams. Its role as a nucleophilic reagent makes it essential in the synthesis of pharmaceuticals and agrochemicals. Additionally, it acts as a stabilizer in resins and plastics. This high-purity compound is crucial for researchers and manufacturers seeking reliable and efficient performance in their chemical processes.
CAS Number | 103-83-3 |
Synonyms | N,N-Dimethylbenzenemethanamine; 4-[(Dimethylamino)methyl]styrene; Actiron NX 91; Ancamine BDMA; Araldite Accelerator 062; Araldite DY 062; BDMA; Benzyl-N,N-dimethylamine; DY 062; DY 62; Dabco BDMA; Desmorapid DB; Dimethylbenzylamine; Kaolizer 20; N,N |
Molecular Formula | C9H13N |
Purity | ≥95% |
Documentation | |
Storage | Store at RT |
IUPAC Name | N,N-dimethyl-1-phenylmethanamine |
InChI | InChI=1S/C9H13N/c1-10(2)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
InChIKey | XXBDWLFCJWSEKW-UHFFFAOYSA-N |
SMILES | CN(C)CC1=CC=CC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |