Home
>
Isotope Labeled Compounds>Other Isotope Labeled Compounds>
>
N,N-Dimethylformamide-(carbonyl-13C)
N, N-Dimethylformamide-(carbonyl-13C)(Cat No.:R031282) is a high-purity isotopically labeled compound essential for advanced research in organic chemistry and material science. Featuring a carbon-13 isotope at the carbonyl position, this labeled version of N,N-Dimethylformamide (DMF) is crucial for studying reaction mechanisms, solvent interactions, and isotopic labeling studies. Its precise isotope labeling ensures accurate and reliable analytical results, enhancing the quality of experimental data. N, N-Dimethylformamide-(carbonyl-13C) is widely used in research involving synthetic chemistry, NMR spectroscopy, and analytical applications.
Catalog Number | R031282 |
CAS Number | 32488-43-0 |
Synonyms | Dimethyl [13C]formamide; N,N-Dimethylformamide-13C |
Molecular Formula | C3H7NO |
Purity | 95% |
Storage | -20°C |
IUPAC Name | N,N-dimethylformamide |
InChI | InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i3+1 |
InChIKey | ZMXDDKWLCZADIW-LBPDFUHNSA-N |
SMILES | CN(C)[13CH]=O |