For research use only. Not for therapeutic Use.
N,N-Dimethyloctylamine (CAT: L000241) is a valuable compound primarily used in organic chemistry. It serves as an essential building block for the synthesis of various organic molecules. In organic chemistry, it is employed for its role as a tertiary amine, facilitating reactions such as quaternization, alkylation, and acylation. This compound finds application in the creation of diverse organic compounds, and its versatility makes it a valuable tool for researchers in this field.
CAS Number | 7378-99-6 |
Molecular Formula | C10H23N |
Purity | ≥95% |
IUPAC Name | N,N-dimethyloctan-1-amine |
InChI | InChI=1S/C10H23N/c1-4-5-6-7-8-9-10-11(2)3/h4-10H2,1-3H3 |
InChIKey | UQKAOOAFEFCDGT-UHFFFAOYSA-N |