For research use only. Not for therapeutic Use.
N,N-Dimethyltetradecylamine is a quaternary ammonium compound used in chemical synthesis and industrial applications. It serves as a surfactant, phase transfer catalyst, and intermediate in the production of various chemicals. This compound is essential for studying reaction mechanisms, enhancing catalytic processes, and developing new synthetic methodologies. Researchers and industrial chemists rely on N,N-Dimethyltetradecylamine for precise and reliable results in advanced chemical research and manufacturing, contributing significantly to innovations in material science and production processes.
Catalog Number | R013306 |
CAS Number | 112-75-4 |
Synonyms | N,N-Dimethyl-1-tetradecanamine; Dimethylmyristamine; Farmin DM 4098; Genamin 14R302D; IPL 30; Myristyldimethylamine; N-Tetradecyldimethylamine; NSC 78319; Tetradecyldimethylamine; |
Molecular Formula | C16H35N |
Purity | ≥95% |
Documentation | |
Storage | -20°C |
IUPAC Name | N,N-dimethyltetradecan-1-amine |
InChI | InChI=1S/C16H35N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3/h4-16H2,1-3H3 |
InChIKey | SFBHPFQSSDCYSL-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCN(C)C |