For research use only. Not for therapeutic Use.
N, N’-Ethylenebis(ceramide)(Cat No.:M068432), is a chemical compound used as a lubricant and processing aid in various industries. It is a white, waxy solid and belongs to the class of long-chain amides. This compound is prized for its exceptional lubricating and anti-static properties, making it ideal for applications in plastics, rubber, and textile manufacturing. Additionally, it serves as a mold release agent and a slip agent in the production of polymeric materials. N, N’-Ethylenebis(ceramide) enhances the flow properties of materials, reduces friction, and minimizes surface imperfections, contributing to improved product quality in these industries.
Catalog Number | M068432 |
CAS Number | 110-30-5 |
Molecular Formula | C38H76N2O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | N-[2-(octadecanoylamino)ethyl]octadecanamide |
InChI | InChI=1S/C38H76N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(41)39-35-36-40-38(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-36H2,1-2H3,(H,39,41)(H,40,42) |
InChIKey | RKISUIUJZGSLEV-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCCC(=O)NCCNC(=O)CCCCCCCCCCCCCCCCC |