For research use only. Not for therapeutic Use.
NO-Aspirin (Nitric Oxide-Aspirin) (Cat No.: R046028) is a modified form of aspirin that incorporates nitric oxide (NO) to enhance its therapeutic effects while reducing side effects typically associated with conventional aspirin. The nitric oxide release helps promote vasodilation and has anti-inflammatory properties, potentially benefiting cardiovascular health. NO-Aspirin retains the pain-relieving and anti-inflammatory properties of traditional aspirin, but with reduced gastrointestinal toxicity, making it a promising candidate for long-term treatment of conditions like arthritis, cardiovascular diseases, and other inflammatory disorders.
| CAS Number | 287118-97-2 |
| Synonyms | 2-(Acetyloxy)benzoic Acid 4-[(Nitrooxy)methyl]phenyl Ester; NCX 4040; |
| Molecular Formula | C16H13NO7 |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at -20℃ |
| IUPAC Name | [4-(nitrooxymethyl)phenyl] 2-acetyloxybenzoate |
| InChI | InChI=1S/C16H13NO7/c1-11(18)23-15-5-3-2-4-14(15)16(19)24-13-8-6-12(7-9-13)10-22-17(20)21/h2-9H,10H2,1H3 |
| InChIKey | CTHNKWFUDCMLIQ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)OC2=CC=C(C=C2)CO[N+](=O)[O-] |
