For research use only. Not for therapeutic Use.
NOMEGA-MONOMETHYL-L-ARGININE ACETATE(Cat No.:M080413), commonly abbreviated as L-NMMA acetate, is a derivative of the amino acid L-arginine. It features a methyl group added to the guanidino nitrogen of arginine, forming N^ω-monomethyl-L-arginine, and is coupled with an acetate counterion. This compound is of significant interest in biomedical research due to its role as a competitive inhibitor of nitric oxide synthase (NOS), the enzyme responsible for nitric oxide production. This inhibition is crucial in studies exploring the regulation of blood pressure, immune function, and neurotransmission, making it valuable in cardiovascular and neurobiological research.
CAS Number | 17035-90-4 |
Molecular Formula | C7H16N4O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid |
InChI | InChI=1S/C7H16N4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11)/t5-/m0/s1 |
InChIKey | NTNWOCRCBQPEKQ-YFKPBYRVSA-N |
SMILES | CN=C(N)NCCCC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |