For research use only. Not for therapeutic Use.
Nonactin is a cyclic ionophore antibiotic produced by Streptomyces species, known for its ability to selectively transport monovalent cations like K⁺ and Na⁺ across biological membranes. It is widely used in research to study ion transport, membrane potential, and cation selectivity. Nonactin is also studied for its antimicrobial activity against certain bacteria and fungi. Its unique ionophoric properties make it a critical tool in biophysical studies, particularly in exploring ion channel behavior, energy transduction, and cellular ion homeostasis.
| Catalog Number | I010567 |
| CAS Number | 6833-84-7 |
| Synonyms | Alternative Name: Ammonium Ionophore I |
| Molecular Formula | C40H64O12 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | Soluble to 10 mM in ethanol |
| Storage | Desiccate at -20℃ |
| IUPAC Name | (1R,2R,5R,7R,10S,11S,14S,16S,19R,20R,23R,25R,28S,29S,32S,34S)-2,5,11,14,20,23,29,32-octamethyl-4,13,22,31,37,38,39,40-octaoxapentacyclo[32.2.1.17,10.116,19.125,28]tetracontane-3,12,21,30-tetrone |
| InChI | InChI=1S/C40H64O12/c1-21-17-29-9-13-34(49-29)26(6)38(42)46-23(3)19-31-11-15-36(51-31)28(8)40(44)48-24(4)20-32-12-16-35(52-32)27(7)39(43)47-22(2)18-30-10-14-33(50-30)25(5)37(41)45-21/h21-36H,9-20H2,1-8H3/t21-,22+,23+,24-,25-,26+,27+,28-,29-,30+,31+,32-,33-,34+,35+,36- |
| InChIKey | RMIXHJPMNBXMBU-QIIXEHPYSA-N |
| SMILES | CC1CC2CCC(O2)C(C(=O)OC(CC3CCC(O3)C(C(=O)OC(CC4CCC(O4)C(C(=O)OC(CC5CCC(O5)C(C(=O)O1)C)C)C)C)C)C)C |
