For research use only. Not for therapeutic Use.
Nonadecanoic acid-d37（Cat No.:S000758）, also known as stearic acid-d37, is a deuterated form of nonadecanoic acid where all the hydrogen atoms are replaced with deuterium. This labeled compound has a molecular formula of C19D37O2, making it significantly heavier than its non-deuterated counterpart. It is commonly used in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy for tracing and studying metabolic pathways in pharmaceutical and biochemical research. The presence of deuterium allows for precise tracking and analysis, providing critical insights into lipid metabolism and other biochemical processes.
| Catalog Number | S000758 |
| CAS Number | 1219798-49-8 |
| Molecular Formula | C19HD37O2 |
| Purity | ≥95% |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,19-heptatriacontadeuteriononadecanoic acid |
| InChI | InChI=1S/C19H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h2-18H2,1H3,(H,20,21)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2,16D2,17D2,18D2 |
| InChIKey | ISYWECDDZWTKFF-UQCHHHBTSA-N |
| SMILES | CCCCCCCCCCCCCCCCCCC(=O)O |
