For research use only. Not for therapeutic Use.
Nonane, 3,7-dimethyl-(Cat No.:M086775) is a branched alkane, a type of hydrocarbon molecule consisting of a nine-carbon chain with two methyl groups attached to the third and seventh carbons, respectively. Its chemical formula is C11H24. This structure makes it part of the isoparaffins, a group of highly branched, saturated hydrocarbons. 3,7-Dimethylnonane is primarily used as a component in the formulation of jet fuels and other high-performance fuels due to its volatility and combustion properties. It also finds applications in the production of lubricants and the chemical synthesis of other compounds.
CAS Number | 17302-32-8 |
Synonyms | Nonane,3,7-dimethyl- |
Molecular Formula | C11H24 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3,7-dimethylnonane |
InChI | InChI=1S/C11H24/c1-5-10(3)8-7-9-11(4)6-2/h10-11H,5-9H2,1-4H3 |
InChIKey | YGPVLXJHRFZYJJ-UHFFFAOYSA-N |
SMILES | CCC(C)CCCC(C)CC |