For research use only. Not for therapeutic Use.
Nonanoic acid-d17(Cat No.:S000784) is an isotopically labeled form of nonanoic acid, a saturated fatty acid with nine carbon atoms. The “d17” designation indicates that all but one hydrogen atom in the nonanoic acid molecule is replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling facilitates precise tracking of nonanoic acid metabolism and its incorporation into lipid pathways using advanced analytical techniques like mass spectrometry. Nonanoic acid-d17 serves as a valuable tool in lipid metabolism studies, aiding in elucidating pathways and understanding the role of fatty acids in cellular physiology.
CAS Number | 130348-94-6 |
Molecular Formula | C9HD17O2 |
Purity | ≥95% |
Target | Bacterial |
IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecadeuteriononanoic acid |
InChI | InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2 |
InChIKey | FBUKVWPVBMHYJY-OISRNESJSA-N |
SMILES | CCCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |