For research use only. Not for therapeutic Use.
Noopept(Cat No.:I001994)is a nootropic compound that is often used to enhance cognitive function, improve memory, and support brain health. It is chemically similar to the racetam family of nootropics but is considered more potent. Noopept works by stimulating the production of brain-derived neurotrophic factor (BDNF) and other neurotrophins, which play a critical role in brain plasticity and cognitive function. Additionally, it has antioxidant and neuroprotective properties, potentially protecting the brain from oxidative stress. While popular in cognitive enhancement circles, further clinical research is needed to fully establish its long-term safety and efficacy.
Catalog Number | I001994 |
CAS Number | 157115-85-0 |
Synonyms | ethyl 2-(1-(2-phenylacetyl)pyrrolidine-2-carboxamido)acetate |
Molecular Formula | C17H22N2O4 |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | ethyl 2-[[(2S)-1-(2-phenylacetyl)pyrrolidine-2-carbonyl]amino]acetate |
InChI | InChI=1S/C17H22N2O4/c1-2-23-16(21)12-18-17(22)14-9-6-10-19(14)15(20)11-13-7-4-3-5-8-13/h3-5,7-8,14H,2,6,9-12H2,1H3,(H,18,22)/t14-/m0/s1 |
InChIKey | PJNSMUBMSNAEEN-AWEZNQCLSA-N |
SMILES | CCOC(=O)CNC(=O)[C@@H]1CCCN1C(=O)CC2=CC=CC=C2 |