For research use only. Not for therapeutic Use.
Norartocarpetin（Cat No.:I043042）is a flavonoid compound found in various plants, particularly in species of the Artocarpus genus, such as jackfruit. It has shown promising biological activities, including antioxidant, anti-inflammatory, and anticancer properties. Studies suggest that norartocarpetin may help in the regulation of various cellular pathways involved in oxidative stress, immune response, and cancer cell proliferation. Additionally, it may have neuroprotective effects and potential benefits in cardiovascular health. Due to its diverse biological effects, norartocarpetin is being explored for potential therapeutic applications in treating chronic diseases.
| CAS Number | 520-30-9 |
| Synonyms | 2-(2,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| Molecular Formula | C15H10O6 |
| Purity | ≥95% |
| IUPAC Name | 2-(2,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| InChI | InChI=1S/C15H10O6/c16-7-1-2-9(10(18)3-7)13-6-12(20)15-11(19)4-8(17)5-14(15)21-13/h1-6,16-19H |
| InChIKey | ZSYPIPFQOQGYHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)C2=CC(=O)C3=C(C=C(C=C3O2)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
