For research use only. Not for therapeutic Use.
Norcamphor(Cat No.:R028097), is a bicyclic organic compound derived from camphor. It has a unique molecular structure consisting of a fused bicycle frame with a ketone functional group. Norcamphor is often employed in organic synthesis as a chiral building block and as a precursor in the preparation of various pharmaceuticals, perfumes, and flavoring agents. Its chirality makes it valuable in asymmetric synthesis, allowing for the creation of enantiomerically pure compounds. Additionally, norcamphor exhibits interesting chemical reactivity, making it a versatile tool in the field of organic chemistry for creating complex molecules with specific stereochemistry.
CAS Number | 497-38-1 |
Synonyms | 2-Norbornanone; (±)-2-Norbornanone; (±)-Norcamphor; 2,5-Methanocyclohexanone; 2-Oxonorbornane; NSC 66537; NSC 92359; Racemic Norcamphor; dl-Norcamphor |
Molecular Formula | C7H10O |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | bicyclo[2.2.1]heptan-3-one |
InChI | InChI=1S/C7H10O/c8-7-4-5-1-2-6(7)3-5/h5-6H,1-4H2 |
InChIKey | KPMKEVXVVHNIEY-UHFFFAOYSA-N |
SMILES | C1CC2CC1CC2=O |