For research use only. Not for therapeutic Use.
Nordihydro Guaiaretic Acid-d6 is a deuterated form of nordihydroguaiaretic acid, a naturally occurring lignan known for its antioxidant properties. This compound, labeled with six deuterium atoms, is essential for advanced pharmacokinetic and metabolic studies. The deuterium labeling allows for precise analysis using mass spectrometry, making it an invaluable tool in research focused on oxidative stress, inflammation, and cancer, where nordihydroguaiaretic acid is often studied for its potential therapeutic benefits. Nordihydro Guaiaretic Acid-d6 provides enhanced stability and accuracy in tracing the compound’s behavior in biological systems, making it ideal for detailed studies in drug development and biochemical research.
Catalog Number | R052845 |
CAS Number | 1346600-58-5 |
Synonyms | 4,4’-(2,3-Dimethyl-1,4-butanediyl)bis-1,2-benzene-d3-diol; 4,4’-(2,3-Dimethyltetramethylene)dipyrocatechol-d6; Dihydronorguaiaretic Acid-d6; NDGA-d6; NSC 4291-d6; Nordihydroguaiaretic Acid-d6; β,γ-Dimethyl-α,δ-bis(3,4-dihydroxyphenyl-d3)butane; |
Molecular Formula | C18H22O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3,4,6-trideuterio-5-[2,3-dimethyl-4-(2,3,6-trideuterio-4,5-dihydroxyphenyl)butyl]benzene-1,2-diol |
InChI | InChI=1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3/i3D,4D,5D,6D,9D,10D |
InChIKey | HCZKYJDFEPMADG-LJYPPAMPSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1CC(C)C(C)CC2=C(C(=C(C(=C2[2H])[2H])O)O)[2H])[2H])O)O)[2H] |