For research use only. Not for therapeutic Use.
Normaprotiline（Cat No.:R034940）is a tricyclic antidepressant and the active metabolite of maprotiline, used to treat major depressive disorders. It works by inhibiting the reuptake of norepinephrine and, to a lesser extent, serotonin, thereby increasing their levels in the brain and improving mood and emotional balance. Normaprotiline also exhibits anxiolytic properties, making it effective for patients with co-occurring anxiety. Its pharmacokinetic profile allows for sustained therapeutic effects, contributing to the management of chronic depression. Ongoing research explores its potential benefits and mechanisms, aiming to optimize its use in clinical practice.
| Catalog Number | R034940 |
| CAS Number | 5721-37-9 |
| Synonyms | Desmethylmaprotiline; Demethylmaprotiline; N-Desmethylmaprotiline; 9,10-Ethanoanthracene-9(10H)-propylamine |
| Molecular Formula | C19H21N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propan-1-amine |
| InChI | InChI=1S/C19H21N/c20-13-5-11-19-12-10-14(15-6-1-3-8-17(15)19)16-7-2-4-9-18(16)19/h1-4,6-9,14H,5,10-13,20H2 |
| InChIKey | IFHUOEQJTQWFGJ-UHFFFAOYSA-N |
| SMILES | C1CC2(C3=CC=CC=C3C1C4=CC=CC=C42)CCCN |
