For research use only. Not for therapeutic Use.
Norstictic acid（Cat No.:M012727）is a lichen-derived secondary metabolite, predominantly found in various species of the family Parmeliaceae. This depsidone compound exhibits notable bioactive properties, including antimicrobial, antioxidant, and anti-inflammatory effects. It plays a significant role in the ecological interactions of lichens, contributing to their defense mechanisms against microbial attacks and environmental stressors. Norstictic acid is also used in chemotaxonomy for lichen identification and classification. Its potential therapeutic applications are being explored in pharmaceutical research, where it shows promise in developing natural bioactive agents for health and medicinal purposes.
| Catalog Number | M012727 |
| CAS Number | 571-67-5 |
| Synonyms | 5,13,17-trihydroxy-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-4-carbaldehyde |
| Molecular Formula | C18H12O9 |
| Purity | ≥95% |
| IUPAC Name | 5,13,17-trihydroxy-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-4-carbaldehyde |
| InChI | InChI=1S/C18H12O9/c1-5-3-8(20)7(4-19)14-9(5)16(22)26-13-6(2)12(21)10-11(15(13)25-14)18(24)27-17(10)23/h3-4,18,20-21,24H,1-2H3 |
| InChIKey | IEVVSJFLBYOUCJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1C(=O)OC3=C(O2)C4=C(C(=C3C)O)C(=O)OC4O)C=O)O |
