For research use only. Not for therapeutic Use.
Nortrachelogenin (Cat No.: R011461) is a naturally occurring compound derived from plants, specifically from species like Trachelospermum jasminoides. It has shown potential as a bioactive agent with various pharmacological properties, including antioxidant and anti-inflammatory effects. Research suggests that nortrachelogenin may help modulate the immune response, protect against oxidative damage, and have potential anticancer properties. Though it has demonstrated promise in preliminary studies, further clinical research is needed to fully understand its therapeutic potential and mechanisms of action in human health.
| CAS Number | 34444-37-6 |
| Molecular Formula | C20H22O7 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | Store at -20°C |
| IUPAC Name | (3S,4S)-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| InChI | InChI=1S/C20H22O7/c1-25-17-8-12(3-5-15(17)21)7-14-11-27-19(23)20(14,24)10-13-4-6-16(22)18(9-13)26-2/h3-6,8-9,14,21-22,24H,7,10-11H2,1-2H3/t14-,20-/m0/s1 |
| InChIKey | ZITBJWXLODLDRH-XOBRGWDASA-N |
| SMILES | COC1=C(C=CC(=C1)CC2COC(=O)C2(CC3=CC(=C(C=C3)O)OC)O)O |
