For research use only. Not for therapeutic Use.
Nortriptyline (Cat No.:I008330) is a tricyclic antidepressant medication used primarily for the treatment of major depressive disorder. By increasing the levels of neurotransmitters like serotonin and norepinephrine in the brain, it helps improve mood and alleviate depressive symptoms. Nortriptyline has also been used off-label for conditions such as chronic pain, migraines, and smoking cessation.
| Catalog Number | I008330 |
| CAS Number | 72-69-5 |
| Synonyms | Nortriptyline, Allegron, Aventyl, Desitriptyline, Desmethylamitriptylin;3-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylidene)-N-methylpropan-1-amine |
| Molecular Formula | C19H21N |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | Soluble in DMSO, not in water |
| Storage | 4°C, protect from light |
| IUPAC Name | 3-(5,6-dihydrodibenzo[2,1-b:2/',1/'-f][7]annulen-11-ylidene)-N-methylpropan-1-amine |
| InChI | InChI=1S/C19H21N/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19/h2-5,7-11,20H,6,12-14H2,1H3 |
| InChIKey | PHVGLTMQBUFIQQ-UHFFFAOYSA-N |
| SMILES | CNCCC=C1C2=CC=CC=C2CCC3=CC=CC=C31 |
