For research use only. Not for therapeutic Use.
Norwogonin（Cat No.:I017077）is a flavonoid compound derived from natural sources, known for its diverse pharmacological properties. It exhibits significant antioxidant and anti-inflammatory activities, making it a valuable candidate for studies on oxidative stress and inflammation-related diseases. Norwogonin also shows potential in modulating signaling pathways involved in cancer and neuroprotection, including its effects on apoptosis and cell proliferation. As a bioactive molecule, it is widely utilized in research exploring natural products for therapeutic applications. Its versatility highlights its importance in drug discovery and development for various health conditions.
| Catalog Number | I017077 |
| CAS Number | 4443-09-8 |
| Molecular Formula | C₁₅H₁₀O₅ |
| Purity | ≥95% |
| Target | Enterovirus |
| IUPAC Name | 5,7,8-trihydroxy-2-phenylchromen-4-one |
| InChI | InChI=1S/C15H10O5/c16-9-6-11(18)14(19)15-13(9)10(17)7-12(20-15)8-4-2-1-3-5-8/h1-7,16,18-19H |
| InChIKey | ZFKKRRMUPBBYRS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)O |
| Reference | [1]. Choi HJ, et al. Inhibitory Effects of Norwogonin, Oroxylin A, and Mosloflavone on Enterovirus 71. Biomol Ther (Seoul). 2016 Sep 1;24(5):552-8. |
