For research use only. Not for therapeutic Use.
Novobiocin(CAT: R060001) is an aminocoumarin antibiotic primarily known for its ability to inhibit bacterial DNA gyrase, an enzyme essential for DNA replication in bacteria. By binding to the GyrB subunit of the enzyme, Novobiocin effectively disrupts bacterial DNA synthesis, making it useful against a range of Gram-positive bacteria. It has also been studied for its potential as an anticancer agent, as it can inhibit heat shock protein 90 (Hsp90), a molecular chaperone involved in cancer cell survival and proliferation. Due to its dual biological activities, Novobiocin is a valuable compound in both microbiology and cancer research.
Catalog Number | R060001 |
CAS Number | 303-81-1 |
Synonyms | N-[7-[[3-O-(aminocarbonyl)-6-deoxy-5-C-methyl-4-O-methyl-α-L-lyxo-hexopyranosyl]oxy]-4-hydroxy-8-methyl-2-oxo-2H-1-benzopyran-3-yl]-4-hydroxy-3-(3-methyl-2-buten-1-yl)benzamide; ?N-[7-[[3-O-(aminocarbonyl)-6-deoxy-5-C-methyl-4-O-methyl-α-L-lyxo-hexop |
Molecular Formula | C31H36N2O11 |
Purity | ≥95% |
Storage | Store at -80C |
IUPAC Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
InChI | InChI=1S/C31H36N2O11/c1-14(2)7-8-16-13-17(9-11-19(16)34)27(37)33-21-22(35)18-10-12-20(15(3)24(18)42-28(21)38)41-29-23(36)25(43-30(32)39)26(40-6)31(4,5)44-29/h7,9-13,23,25-26,29,34-36H,8H2,1-6H3,(H2,32,39)(H,33,37)/t23-,25+,26-,29-/m1/s1 |
InChIKey | YJQPYGGHQPGBLI-KGSXXDOSSA-N |
SMILES | CC1=C(C=CC2=C1OC(=O)C(=C2O)NC(=O)C3=CC(=C(C=C3)O)CC=C(C)C)OC4C(C(C(C(O4)(C)C)OC)OC(=O)N)O |