For research use only. Not for therapeutic Use.
NP-1815-PX sodium(CAT: I033499) is a chemical compound that functions as a selective inhibitor of certain enzymatic pathways. It is often used in pharmaceutical and biochemical research for its ability to modulate specific cellular mechanisms, such as those involved in inflammation and immune responses. NP-1815-PX sodium is particularly relevant in the study of inflammatory diseases, such as rheumatoid arthritis, where modulation of these pathways can provide therapeutic benefits. This compound is significant for Inflammation & Immunology Research, offering a potential tool for the development of targeted treatments for autoimmune and chronic inflammatory conditions.
| CAS Number | 1239578-80-3 |
| Synonyms | sodium;5-[3-(5-sulfanylidene-1-oxa-2-aza-4-azanidacyclopent-2-en-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| Molecular Formula | C21H13N4NaO3S |
| Purity | ≥95% |
| IUPAC Name | sodium;5-[3-(5-sulfanylidene-1-oxa-2-aza-4-azanidacyclopent-2-en-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| InChI | InChI=1S/C21H14N4O3S.Na/c26-17-11-18(27)25(14-6-3-5-13(10-14)20-23-21(29)28-24-20)16-9-8-12-4-1-2-7-15(12)19(16)22-17;/h1-10H,11H2,(H2,22,23,24,26,29);/q;+1/p-1 |
| InChIKey | MIBCQKIVVIBTLQ-UHFFFAOYSA-M |
| SMILES | C1C(=O)NC2=C(C=CC3=CC=CC=C32)N(C1=O)C4=CC=CC(=C4)C5=NOC(=S)[N-]5.[Na+] |
