For research use only. Not for therapeutic Use.
NP118809(Cat No.:I003499)is an investigational small molecule being studied for its potential as a therapeutic agent in cancer treatment. It functions as an inhibitor of the bromodomain and extraterminal (BET) family of proteins, particularly targeting BRD4, which plays a crucial role in regulating gene expression and promoting tumor cell growth. By inhibiting BRD4, NP118809 aims to block oncogenic transcriptional programs, thereby slowing or halting cancer progression. Preclinical studies suggest its potential efficacy in various cancers, including hematological malignancies and solid tumors. Further clinical trials are needed to evaluate its safety, pharmacodynamics, and therapeutic potential.
CAS Number | 41332-24-5 |
Synonyms | 1-(4-benzhydrylpiperazin-1-yl)-3,3-diphenylpropan-1-one |
Molecular Formula | C32H32N2O |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | 0.11 uM (for N-type Calcium channel) |
IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-3,3-diphenylpropan-1-one |
InChI | InChI=1S/C32H32N2O/c35-31(25-30(26-13-5-1-6-14-26)27-15-7-2-8-16-27)33-21-23-34(24-22-33)32(28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-20,30,32H,21-25H2 |
InChIKey | VCPMZDWBEWTGNW-UHFFFAOYSA-N |
SMILES | C1CN(CCN1C(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)CC(C4=CC=CC=C4)C5=CC=CC=C5 |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |