For research use only. Not for therapeutic Use.
NPD-001（Cat No.:I033511）is a selective small-molecule inhibitor designed to target monoamine oxidase B (MAO-B), an enzyme involved in the breakdown of dopamine. By inhibiting MAO-B, NPD-001 helps increase dopamine levels in the brain, making it a potential therapeutic agent for neurodegenerative disorders like Parkinson’s disease. Its selective action reduces the risk of off-target effects, minimizing the likelihood of side effects often associated with non-selective MAO inhibitors. NPD-001’s role in elevating dopamine levels highlights its value in neurological research and potential in enhancing motor and cognitive function in related conditions.
| Catalog Number | I033511 |
| CAS Number | 469863-16-9 |
| Synonyms | NPD-001; NPD 001; NPD001. |
| Molecular Formula | C33H40N6O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| InChI | InChI=1S/C33H40N6O4/c1-41-29-19-16-24(31-27-12-6-7-13-28(27)33(40)39(36-31)25-10-4-2-3-5-11-25)22-30(29)43-21-9-8-20-42-26-17-14-23(15-18-26)32-34-37-38-35-32/h6-7,14-19,22,25,27-28H,2-5,8-13,20-21H2,1H3,(H,34,35,37,38)/t27-,28+/m0/s1 |
| InChIKey | DNDNLFXKQSTINI-WUFINQPMSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NN(C(=O)[C@H]3[C@@H]2CC=CC3)C4CCCCCC4)OCCCCOC5=CC=C(C=C5)C6=NNN=N6 |
| Reference | 1: Veerman J, van den Bergh T, Orrling KM, Jansen C, Cos P, Maes L, Chatelain E, |
