For research use only. Not for therapeutic Use.
NQ-301（Cat No.:I008352）is a novel, small-molecule compound being investigated for its potential neuroprotective and neuroregenerative properties. It is known to activate the NQO1 (NAD(P)H quinone dehydrogenase 1) enzyme, which plays a role in antioxidant defense and cellular protection against oxidative stress. NQ-301 has shown promise in preclinical studies for its ability to protect neurons from damage caused by neurodegenerative diseases, such as Alzheimer’s and Parkinson’s. It is being explored as a potential therapeutic agent to mitigate cognitive decline, improve memory, and promote neural health in conditions associated with aging and neurodegeneration.
| Catalog Number | I008352 |
| CAS Number | 130089-98-4 |
| Synonyms | NQ-301; NQ 301; NQ301.;2-[(4-Acetylphenyl)amino]-3-chloro-1,4-naphthalenedione |
| Molecular Formula | C18H12ClNO3 |
| Purity | ≥95% |
| Target | Thrombin |
| Solubility | Soluble in DMSO |
| Storage | 4°C |
| IC50 | 200 nM |
| IUPAC Name | 2-(4-acetylanilino)-3-chloronaphthalene-1,4-dione |
| InChI | InChI=1S/C18H12ClNO3/c1-10(21)11-6-8-12(9-7-11)20-16-15(19)17(22)13-4-2-3-5-14(13)18(16)23/h2-9,20H,1H3 |
| InChIKey | LSQZKIQSQHZVQS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)NC2=C(C(=O)C3=CC=CC=C3C2=O)Cl |
