For research use only. Not for therapeutic Use.
NR2F6 Modulator-1（Cat No.:I043428）is a small molecule designed to target and modulate the activity of NR2F6, a nuclear receptor involved in immune system regulation and inflammatory responses. NR2F6 plays a crucial role in maintaining immune tolerance and regulating T-cell differentiation. By modulating NR2F6 activity, Modulator-1 aims to influence immune responses, potentially offering therapeutic benefits in autoimmune diseases, inflammatory conditions, and cancer immunotherapy. Preclinical research suggests that NR2F6 Modulator-1 could enhance immune system function, making it a promising candidate for further investigation in immune-related therapies.
| CAS Number | 904449-84-9 |
| Synonyms | 3-(benzenesulfonyl)-N-benzyl-2-oxochromene-6-carboxamide |
| Molecular Formula | C23H17NO5S |
| Purity | ≥95% |
| IUPAC Name | 3-(benzenesulfonyl)-N-benzyl-2-oxochromene-6-carboxamide |
| InChI | InChI=1S/C23H17NO5S/c25-22(24-15-16-7-3-1-4-8-16)17-11-12-20-18(13-17)14-21(23(26)29-20)30(27,28)19-9-5-2-6-10-19/h1-14H,15H2,(H,24,25) |
| InChIKey | ZNYVQFURPOKGQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC3=C(C=C2)OC(=O)C(=C3)S(=O)(=O)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
