For research use only. Not for therapeutic Use.
Nrf2 activator-3（Cat No.:I041195）is a small molecule compound designed to activate the Nrf2 (nuclear factor erythroid 2-related factor 2) pathway, which plays a key role in cellular defense against oxidative stress and inflammation. By activating Nrf2, this compound aims to enhance the body’s antioxidant response, promote detoxification, and protect cells from damage caused by environmental stressors and diseases. Nrf2 activator-3 shows potential in treating conditions associated with oxidative damage, including neurodegenerative diseases, cardiovascular disorders, and cancer. Ongoing research is focused on evaluating its safety, efficacy, and therapeutic potential in various clinical settings.
| CAS Number | 2766570-23-2 |
| Synonyms | 2-[1-(3,5-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]-5-(trifluoromethyl)phenol |
| Molecular Formula | C23H18F3N3O2 |
| Purity | ≥95% |
| IUPAC Name | 2-[1-(3,5-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]-5-(trifluoromethyl)phenol |
| InChI | InChI=1S/C23H18F3N3O2/c1-13-9-14(2)11-16(10-13)29-22(18-5-3-4-6-19(18)30)27-21(28-29)17-8-7-15(12-20(17)31)23(24,25)26/h3-12,30-31H,1-2H3 |
| InChIKey | INMUTDNBXNPVRS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C(=NC(=N2)C3=C(C=C(C=C3)C(F)(F)F)O)C4=CC=CC=C4O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
