For research use only. Not for therapeutic Use.
NRP1 Antagonist 1（Cat No.:I043584）is a small molecule designed to inhibit Neuropilin-1 (NRP1), a receptor involved in various cellular processes, including angiogenesis and tumor growth. NRP1 plays a critical role in the signaling pathways of growth factors like VEGF and semaphorins, which are associated with cancer progression and metastasis. By blocking NRP1, this antagonist potentially disrupts tumor blood vessel formation, reducing cancer cell proliferation and migration. Preclinical studies suggest its effectiveness in inhibiting tumor growth, and it holds promise as a therapeutic candidate for cancer and other diseases involving aberrant angiogenesis.
| CAS Number | 2569598-01-0 |
| Synonyms | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[4-(3-methylphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| Molecular Formula | C22H22N6OS2 |
| Purity | ≥95% |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[4-(3-methylphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| InChI | InChI=1S/C22H22N6OS2/c1-4-19-24-26-21(31-19)23-18(29)13-30-22-27-25-20(16-10-8-14(2)9-11-16)28(22)17-7-5-6-15(3)12-17/h5-12H,4,13H2,1-3H3,(H,23,26,29) |
| InChIKey | OWXHHEPYWMHKHC-UHFFFAOYSA-N |
| SMILES | CCC1=NN=C(S1)NC(=O)CSC2=NN=C(N2C3=CC=CC(=C3)C)C4=CC=C(C=C4)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
