For research use only. Not for therapeutic Use.
NS-8(CAT: I012355) is a novel compound that acts as an opener of the large conductance calcium-activated potassium channels (BK(Ca) or maxi-K(+) channels). It specifically activates the calcium-sensitive potassium channel of the bladder, leading to a suppression of the micturition reflex by reducing the activity of the afferent pelvic nerves. NS-8 is used as an activator of the BKCa channel for the treatment of muscular disorders. It offers potential therapeutic benefits in conditions where modulation of potassium channels is desired.
| Catalog Number | I012355 |
| CAS Number | 186033-14-7 |
| Synonyms | NS8; 2-Amino-3-cyano-5-(2-fluorophenyl)-4-methylpyrrole |
| Molecular Formula | C12H10FN3 |
| Purity | ≥95% |
| Target | Potassium Channel |
| IUPAC Name | 2-amino-5-(2-fluorophenyl)-4-methyl-1H-pyrrole-3-carbonitrile |
| InChI | InChI=1S/C12H10FN3/c1-7-9(6-14)12(15)16-11(7)8-4-2-3-5-10(8)13/h2-5,16H,15H2,1H3 |
| InChIKey | KVDWOQGDMAEJLM-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=C1C#N)N)C2=CC=CC=C2F |
| Reference | 1. Selwood, D., et al.: PCT Int. Appl. 44 pp. (2016) |
