For research use only. Not for therapeutic Use.
NS2B/NS3-IN-3（Cat No.:I043624）is a potent inhibitor targeting the NS2B-NS3 protease complex, crucial for the replication of flaviviruses, including Dengue and Zika viruses. By inhibiting this protease, NS2B/NS3-IN-3 disrupts the viral replication process, preventing the virus from maturing and infecting host cells. It has demonstrated significant antiviral activity in preclinical studies, making it a promising candidate for the development of antiviral therapies. Ongoing research focuses on optimizing its efficacy and safety for potential clinical use in treating flavivirus infections and other related viral diseases.
| CAS Number | 2832876-90-9 |
| Synonyms | 6-(furan-3-yl)-N-(piperidin-4-ylmethyl)-1H-indole-2-carboxamide |
| Molecular Formula | C19H21N3O2 |
| Purity | ≥95% |
| IUPAC Name | 6-(furan-3-yl)-N-(piperidin-4-ylmethyl)-1H-indole-2-carboxamide |
| InChI | InChI=1S/C19H21N3O2/c23-19(21-11-13-3-6-20-7-4-13)18-10-15-2-1-14(9-17(15)22-18)16-5-8-24-12-16/h1-2,5,8-10,12-13,20,22H,3-4,6-7,11H2,(H,21,23) |
| InChIKey | WTTOXJPIYYZQSP-UHFFFAOYSA-N |
| SMILES | C1CNCCC1CNC(=O)C2=CC3=C(N2)C=C(C=C3)C4=COC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
