For research use only. Not for therapeutic Use.
NSC 111091 is a bioactive chemical.
| Catalog Number | I033553 |
| CAS Number | 75291-65-5 |
| Synonyms | NSC 111091; NSC-111091; NSC111091 |
| Molecular Formula | C22H23N5O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N'-(4-(Hydroxy(oxido)amino)phenyl)-N-(4-(4-morpholinyl)-2-pyridinyl)-N-phenylurea |
| InChI | InChI=1S/C22H23N5O4/c28-22(24-17-6-8-19(9-7-17)27(29)30)26(18-4-2-1-3-5-18)21-16-20(10-11-23-21)25-12-14-31-15-13-25/h1-11,16,27,29H,12-15H2,(H,24,28) |
| InChIKey | SXJXRXFSMUYBPR-UHFFFAOYSA-N |
| SMILES | O=C(NC1=CC=C([NH+](O)[O-])C=C1)N(C2=NC=CC(N3CCOCC3)=C2)C4=CC=CC=C4 |
