For research use only. Not for therapeutic Use.
NSC 146109 hydrochloride (CAT: R041712) is a synthetic chemical compound with potential applications in cancer research and therapy. This compound is an inhibitor of protein kinase C (PKC), a group of enzymes involved in cell signaling pathways and regulation. By targeting PKC, NSC 146109 hydrochloride interferes with cellular processes like proliferation, differentiation, and apoptosis, which are often dysregulated in cancer cells. This compound holds promise as a tool in studying PKC-related pathways and may contribute to the development of novel cancer treatments.
| Catalog Number | R041712 |
| CAS Number | 59474-01-0 |
| Synonyms | (10-methyl-9-anthracenyl)methyl Ester Carbamimidothioic Acid Monohydrochloride; NSC 146109; |
| Molecular Formula | C₁₇H₁₆N₂S.HCl |
| Purity | ≥95% |
| Target | MDM-2/p53 |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Desiccate at RT |
| InChI | InChI=1S/C17H16N2S.ClH/c1-11-12-6-2-4-8-14(12)16(10-20-17(18)19)15-9-5-3-7-13(11)15;/h2-9H,10H2,1H3,(H3,18,19);1H |
| InChIKey | VIBMUYOXJUCEMA-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC=CC2=C(C3=CC=CC=C13)CSC(=N)N.Cl |
