For research use only. Not for therapeutic Use.
NSC-33994(Cat No.:R056716)is a small molecule compound known for its ability to inhibit the activity of the histone methyltransferase EZH2, a key player in the regulation of gene expression through trimethylation of histone H3 at lysine 27 (H3K27me3). By targeting EZH2, NSC-33994 can reverse gene silencing associated with cancer progression and has shown potential in preclinical studies for treating various malignancies, including hematological cancers. Its selective action makes it a promising candidate for further research into epigenetic therapies aimed at reactivating tumor suppressor genes and combating drug resistance.
CAS Number | 82058-16-0 |
Synonyms | 4,4’-[(1E)-1,2-Diethyl-1,2-ethenediyl]bis[2-[(diethylamino)methyl]phenol; (E)-4,4’-(1,2-Diethyl-1,2-ethenediyl)bis[2-[(diethylamino)methyl]phenol; |
Molecular Formula | C28H42N2O2 |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | Limited solubility |
Storage | Store at -20°C |
IUPAC Name | 2-(diethylaminomethyl)-4-[(E)-4-[3-(diethylaminomethyl)-4-hydroxyphenyl]hex-3-en-3-yl]phenol |
InChI | InChI=1S/C28H42N2O2/c1-7-25(21-13-15-27(31)23(17-21)19-29(9-3)10-4)26(8-2)22-14-16-28(32)24(18-22)20-30(11-5)12-6/h13-18,31-32H,7-12,19-20H2,1-6H3/b26-25+ |
InChIKey | QFNJFVBKASKGEU-OCEACIFDSA-N |
SMILES | CC/C(=C(/CC)\C1=CC(=C(C=C1)O)CN(CC)CC)/C2=CC(=C(C=C2)O)CN(CC)CC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |