For research use only. Not for therapeutic Use.
NSC 341077 is a bioactive chemical.
| Catalog Number | I033602 |
| CAS Number | 73610-81-8 |
| Synonyms | NSC 341077; NSC-341077; NSC341077; |
| Molecular Formula | C35H43N11O14 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (3S,8S,13S,18S)-1-(4-(((2,4-diaminopteridin-6-yl)methyl)(methyl)amino)phenyl)-1,6,11,16-tetraoxo-2,7,12,17-tetraazaicosane-3,8,13,18,20-pentacarboxylic acid |
| InChI | InChI=1S/C35H43N11O14/c1-46(15-17-14-38-29-27(39-17)28(36)44-35(37)45-29)18-4-2-16(3-5-18)30(52)43-22(34(59)60)8-12-25(49)41-20(32(55)56)6-10-23(47)40-19(31(53)54)7-11-24(48)42-21(33(57)58)9-13-26(50)51/h2-5,14,19-22H,6-13,15H2,1H3,(H,40,47)(H,41,49)(H,42,48)(H,43,52)(H,50,51)(H,53,54)(H,55,56)(H,57,58)(H,59,60)(H4,36,37,38,44,45)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | UORBZCNWEGKEOP-CMOCDZPBSA-N |
| SMILES | O=C(O)CC[C@@H](C(O)=O)NC(CC[C@@H](C(O)=O)NC(CC[C@@H](C(O)=O)NC(CC[C@@H](C(O)=O)NC(C1=CC=C(N(CC2=NC3=C(N)N=C(N)N=C3N=C2)C)C=C1)=O)=O)=O)=O |
