For research use only. Not for therapeutic Use.
NSC348884(Cat No.:I004960)is a small molecule compound that has shown potential as an anticancer agent in preclinical studies. It belongs to a class of compounds that target the tumor microenvironment and interfere with various cellular processes, including protein synthesis and cell cycle regulation. Research suggests that NSC-348884 may have activity against certain cancer types, such as breast and prostate cancer, by promoting apoptosis and inhibiting tumor growth. However, further studies are needed to evaluate its efficacy and safety in clinical settings.
CAS Number | 81624-55-7 |
Synonyms | N1,N1,N2,N2-tetrakis((6-methyl-1H-benzo[d]imidazol-2-yl)methyl)ethane-1,2-diamine |
Molecular Formula | C₃₈H₄₀N₁₀ |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 34 mg/mL |
Storage | 2-8°C |
IUPAC Name | N,N,N',N'-tetrakis[(6-methyl-1H-benzimidazol-2-yl)methyl]ethane-1,2-diamine |
InChI | InChI=1S/C38H40N10/c1-23-5-9-27-31(15-23)43-35(39-27)19-47(20-36-40-28-10-6-24(2)16-32(28)44-36)13-14-48(21-37-41-29-11-7-25(3)17-33(29)45-37)22-38-42-30-12-8-26(4)18-34(30)46-38/h5-12,15-18H,13-14,19-22H2,1-4H3,(H,39,43)(H,40,44)(H,41,45)(H,42,46) |
InChIKey | KZOLQEUQAFTQFM-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=C1)N=C(N2)CN(CCN(CC3=NC4=C(N3)C=C(C=C4)C)CC5=NC6=C(N5)C=C(C=C6)C)CC7=NC8=C(N7)C=C(C=C8)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |