For research use only. Not for therapeutic Use.
NSC 625987（Cat No.:I010515）is a potent experimental compound used in cancer research for its ability to interfere with DNA replication and induce apoptosis in cancer cells. It has shown promising activity as a topoisomerase inhibitor, targeting enzymes essential for DNA unwinding and cell division. By inhibiting topoisomerases, NSC 625987 disrupts DNA repair and replication, leading to cell death, particularly in rapidly proliferating tumor cells. This compound is valuable for studying novel cancer therapies and has potential applications in developing chemotherapeutic agents. It is primarily used in preclinical research and drug development.
| Catalog Number | I010515 |
| CAS Number | 141992-47-4 |
| Synonyms | 1,4-Dimethoxy-9(10H)-acridinethione |
| Molecular Formula | C15H13NO2S |
| Purity | ≥95% |
| Target | Cyclin-Dependent Kinases |
| Solubility | Soluble to 10 mM in ethanol and to 100 mM in DMSO |
| Storage | Store at +4C |
| IUPAC Name | 1,4-dimethoxy-10H-acridine-9-thione |
| InChI | InChI=1S/C15H13NO2S/c1-17-11-7-8-12(18-2)14-13(11)15(19)9-5-3-4-6-10(9)16-14/h3-8H,1-2H3,(H,16,19) |
| InChIKey | KFAKESMKRPNZTM-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)OC)NC3=CC=CC=C3C2=S |
